ChemNet > CAS > 34824-58-3 2-Bromophenyldioxolane
34824-58-3 2-Bromophenyldioxolane
| نام محصول |
2-Bromophenyldioxolane |
| مترادف |
2-(2-Bromophenyl)-1,3-dioxolane; 2-Bromobenzaldehyde ethylene acetal |
| میدان مغناطیسی |
C9H9BrO2 |
| وزن مولکولی |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9H,5-6H2 |
| شماره سیایاس |
34824-58-3 |
| ساختار مولکولی |
|
| تراکم |
1.515g/cm3 |
| نقطه غلیان |
272.1°C at 760 mmHg |
| ضریب شکست |
1.564 |
| نقطه اشتعال |
120.8°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
