ChemNet > CAS > 35112-27-7 Ethyl 2,5-dichlorobenzoate
35112-27-7 Ethyl 2,5-dichlorobenzoate
نام محصول |
Ethyl 2,5-dichlorobenzoate |
مترادف |
2,5-Dichlorobenzoic acid ethyl ester |
میدان مغناطیسی |
C9H8Cl2O2 |
وزن مولکولی |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c1-2-13-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
شماره سیایاس |
35112-27-7 |
تعداد کمیسیون اروپایی |
252-373-6 |
ساختار مولکولی |
|
تراکم |
1.305g/cm3 |
نقطه غلیان |
281.4°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
116.8°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|