ChemNet > CAS > 3512-13-8 2,3,4,6-Tetrafluoropyridine
3512-13-8 2,3,4,6-Tetrafluoropyridine
نام محصول |
2,3,4,6-Tetrafluoropyridine |
میدان مغناطیسی |
C5HF4N |
وزن مولکولی |
151.0618 |
InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
شماره سیایاس |
3512-13-8 |
ساختار مولکولی |
|
تراکم |
1.518g/cm3 |
نقطه غلیان |
114.6°C at 760 mmHg |
ضریب شکست |
1.403 |
نقطه اشتعال |
23.1°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|