ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
نام محصول |
2,6-Dinitrobenzonitrile |
مترادف |
Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
میدان مغناطیسی |
C7H3N3O4 |
وزن مولکولی |
193.1164 |
InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
شماره سیایاس |
35213-00-4 |
ساختار مولکولی |
|
تراکم |
1.555g/cm3 |
نقطه غلیان |
387.959°C at 760 mmHg |
ضریب شکست |
1.616 |
نقطه اشتعال |
188.431°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|