ChemNet > CAS > 538-58-9;35225-79-7 Dibenzylideneacetone
538-58-9;35225-79-7 Dibenzylideneacetone
| نام محصول |
Dibenzylideneacetone |
| مترادف |
1,5-Diphenyl-1,4-pentadien-3-one; distyryl ketone; trans,trans-Dibenzylideneacetone; Dibenzylidene acetone; 1,5-diphenylpenta-1,4-dien-3-one; (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; (1Z,4Z)-1,5-diphenylpenta-1,4-dien-3-one; (1E)-1,5-diphenylpenta-1,4-dien-3-one; 1,5-Diphenyl-3-pentadienone |
| میدان مغناطیسی |
C17H14O |
| وزن مولکولی |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12u |
| شماره سیایاس |
538-58-9;35225-79-7 |
| تعداد کمیسیون اروپایی |
208-697-5 |
| ساختار مولکولی |
|
| تراکم |
1.1g/cm3 |
| نقطه ذوب |
112-114℃ |
| نقطه غلیان |
400.7°C at 760 mmHg |
| ضریب شکست |
1.649 |
| نقطه اشتعال |
176.2°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
