ChemNet > CAS > 3562-73-0 1-(4-Biphenylyl)ethanol
3562-73-0 1-(4-Biphenylyl)ethanol
نام محصول |
1-(4-Biphenylyl)ethanol |
مترادف |
4-Biphenylyl methyl carbinol~4-(1-Hydroxyethyl)biphenyl~alpha-Methyl-4-phenylbenzyl alcohol; 4-(1-Hydroxyethyl)biphenyl; 1-(biphenyl-4-yl)ethanol |
میدان مغناطیسی |
C14H14O |
وزن مولکولی |
198.2604 |
InChI |
InChI=1/C14H14O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-11,15H,1H3 |
شماره سیایاس |
3562-73-0 |
تعداد کمیسیون اروپایی |
222-629-1 |
ساختار مولکولی |
|
تراکم |
1.067g/cm3 |
نقطه ذوب |
95-97℃ |
نقطه غلیان |
340.4°C at 760 mmHg |
ضریب شکست |
1.581 |
نقطه اشتعال |
148.6°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|