ChemNet > CAS > 3622-04-6 1,3-Benzothiazole-2-carboxylic acid
3622-04-6 1,3-Benzothiazole-2-carboxylic acid
نام محصول |
1,3-Benzothiazole-2-carboxylic acid |
مترادف |
benzo[d]thiazole-2-carboxylic acid |
میدان مغناطیسی |
C8H5NO2S |
وزن مولکولی |
179.1958 |
InChI |
InChI=1/C8H5NO2S/c10-8(11)7-9-5-3-1-2-4-6(5)12-7/h1-4H,(H,10,11) |
شماره سیایاس |
3622-04-6 |
ساختار مولکولی |
|
تراکم |
1.508g/cm3 |
نقطه ذوب |
148℃ |
نقطه غلیان |
378.5°C at 760 mmHg |
ضریب شکست |
1.731 |
نقطه اشتعال |
182.7°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|