ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
نام محصول |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
مترادف |
1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
میدان مغناطیسی |
C14H17NO |
وزن مولکولی |
215.2909 |
InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
شماره سیایاس |
36263-51-1 |
تعداد کمیسیون اروپایی |
252-938-7 |
ساختار مولکولی |
|
تراکم |
1.06g/cm3 |
نقطه ذوب |
40-45℃ |
نقطه غلیان |
362°C at 760 mmHg |
ضریب شکست |
1.538 |
نقطه اشتعال |
152.6°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|