ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
| نام محصول |
4-Fluoro-1-iodo-2-nitrobenzene |
| مترادف |
2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
| میدان مغناطیسی |
C6H5FN2O2 |
| وزن مولکولی |
156.1145 |
| InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| شماره سیایاس |
364-77-2 |
| تعداد کمیسیون اروپایی |
206-666-0 |
| ساختار مولکولی |
|
| تراکم |
1.448g/cm3 |
| نقطه غلیان |
295.1°C at 760 mmHg |
| ضریب شکست |
1.603 |
| نقطه اشتعال |
89.4°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
