ChemNet > CAS > 3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
3644-56-2 2-Chloro-N-(2,6-dichlorophenyl)-acetamide
| نام محصول |
2-Chloro-N-(2,6-dichlorophenyl)-acetamide |
| مترادف |
2-Chloro-N-(2,6-dichlorophenyl)acetamide |
| میدان مغناطیسی |
C8H6Cl3NO |
| وزن مولکولی |
238.4983 |
| InChI |
InChI=1/C8H6Cl3NO/c9-4-7(13)12-8-5(10)2-1-3-6(8)11/h1-3H,4H2,(H,12,13) |
| شماره سیایاس |
3644-56-2 |
| تعداد کمیسیون اروپایی |
222-874-4 |
| ساختار مولکولی |
|
| تراکم |
1.511g/cm3 |
| نقطه ذوب |
176-179℃ |
| نقطه غلیان |
376.2°C at 760 mmHg |
| ضریب شکست |
1.616 |
| نقطه اشتعال |
181.3°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|
