ChemNet > CAS > 368869-90-3 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide
368869-90-3 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide
نام محصول |
3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide |
مترادف |
4-fluorobenzenesulfonic acid; 3-(2-chloro-6-fluorophenyl)-N-(2-chloropyridin-3-yl)-5-methylisoxazole-4-carboxamide |
میدان مغناطیسی |
C16H10Cl2FN3O2 |
وزن مولکولی |
366.1739 |
InChI |
InChI=1/C16H10Cl2FN3O2/c1-8-12(16(23)21-11-6-3-7-20-15(11)18)14(22-24-8)13-9(17)4-2-5-10(13)19/h2-7H,1H3,(H,21,23) |
شماره سیایاس |
368869-90-3 |
تعداد کمیسیون اروپایی |
206-714-0 |
ساختار مولکولی |
|
تراکم |
1.481g/cm3 |
نقطه غلیان |
449.8°C at 760 mmHg |
ضریب شکست |
1.634 |
نقطه اشتعال |
225.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|