ChemNet > CAS > 3696-23-9 4-Chlorophenylthiourea
3696-23-9 4-Chlorophenylthiourea
| نام محصول |
4-Chlorophenylthiourea |
| مترادف |
Thourea, (4-chlorophenyl)- (9CI); (4-Chlorophenyl)thiourea; 1-(p-Chlorophenyl)-2-thiourea; 1-(p-Chlorophenyl)thiourea; 4-12-00-01206 (Beilstein Handbook Reference); 4-Chlorophenyl thiourea; BRN 0973258; N-(4-Chlorophenyl)thiourea; N-(p-Chlorophenyl)thiourea; NSC 72217; 4-Chlorophenyl-2-thiourea; Thiourea, (4-chlorophenyl)- (9CI); Urea, 1-(p-chlorophenyl)-2-thio-; 1-(4-chlorophenyl)thiourea |
| میدان مغناطیسی |
C7H7ClN2S |
| وزن مولکولی |
186.6619 |
| InChI |
InChI=1/C7H7ClN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| شماره سیایاس |
3696-23-9 |
| تعداد کمیسیون اروپایی |
223-022-4 |
| ساختار مولکولی |
|
| تراکم |
1.441g/cm3 |
| نقطه غلیان |
298.7°C at 760 mmHg |
| ضریب شکست |
1.727 |
| نقطه اشتعال |
134.5°C |
| خطر نمادها |
|
| کدهای خطر |
R28:Very toxic if swallowed.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
