ChemNet > CAS > 37551-43-2 5-chloro-N,2-dihydroxybenzamide
37551-43-2 5-chloro-N,2-dihydroxybenzamide
نام محصول |
5-chloro-N,2-dihydroxybenzamide |
مترادف |
5-Chloro-N,2-dihydrobenzamide |
میدان مغناطیسی |
C7H6ClNO3 |
وزن مولکولی |
187.5804 |
InChI |
InChI=1/C7H6ClNO3/c8-4-1-2-6(10)5(3-4)7(11)9-12/h1-3,10,12H,(H,9,11) |
شماره سیایاس |
37551-43-2 |
تعداد کمیسیون اروپایی |
253-550-0 |
ساختار مولکولی |
|
تراکم |
1.548g/cm3 |
نقطه ذوب |
208℃ |
ضریب شکست |
1.638 |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|