ChemNet > CAS > 3943-73-5 ethyl 2,3-dihydroxybenzoate
3943-73-5 ethyl 2,3-dihydroxybenzoate
نام محصول |
ethyl 2,3-dihydroxybenzoate |
مترادف |
2,3-Dihydroxy-benzoic acid ethyl ester |
میدان مغناطیسی |
C9H10O4 |
وزن مولکولی |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3 |
شماره سیایاس |
3943-73-5 |
ساختار مولکولی |
|
تراکم |
1.294g/cm3 |
نقطه ذوب |
65℃ |
نقطه غلیان |
307.2°C at 760 mmHg |
ضریب شکست |
1.573 |
نقطه اشتعال |
123°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|