ChemNet > CAS > 39565-00-9 2-Acetyl-5-nitrothiophene
39565-00-9 2-Acetyl-5-nitrothiophene
نام محصول |
2-Acetyl-5-nitrothiophene |
مترادف |
5-Nitro-2-thienyl methyl ketone; Methyl 5-nitro-2-thienyl ketone; 1-(5-nitrothiophen-2-yl)ethanone |
میدان مغناطیسی |
C6H5NO3S |
وزن مولکولی |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3 |
شماره سیایاس |
39565-00-9 |
ساختار مولکولی |
|
تراکم |
1.399g/cm3 |
نقطه غلیان |
268.9°C at 760 mmHg |
ضریب شکست |
1.589 |
نقطه اشتعال |
116.4°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|