ChemNet > CAS > 39593-08-3 Methylphenylpiperazine
39593-08-3 Methylphenylpiperazine
| نام محصول |
Methylphenylpiperazine |
| مترادف |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
| میدان مغناطیسی |
C11H16N2 |
| وزن مولکولی |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
| شماره سیایاس |
39593-08-3 |
| تعداد کمیسیون اروپایی |
254-534-6 |
| ساختار مولکولی |
|
| تراکم |
1.012g/cm3 |
| نقطه غلیان |
321.2°C at 760 mmHg |
| ضریب شکست |
1.54 |
| نقطه اشتعال |
153.8°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
