ChemNet > CAS > 39911-29-0 3-nitro-4-piperidinobenzaldehyde
39911-29-0 3-nitro-4-piperidinobenzaldehyde
نام محصول |
3-nitro-4-piperidinobenzaldehyde |
مترادف |
3-nitro-4-piperidin-1-ylbenzaldehyde |
میدان مغناطیسی |
C12H14N2O3 |
وزن مولکولی |
234.2512 |
InChI |
InChI=1/C12H14N2O3/c15-9-10-4-5-11(12(8-10)14(16)17)13-6-2-1-3-7-13/h4-5,8-9H,1-3,6-7H2 |
شماره سیایاس |
39911-29-0 |
ساختار مولکولی |
|
تراکم |
1.264g/cm3 |
نقطه ذوب |
48℃ |
نقطه غلیان |
408.6°C at 760 mmHg |
ضریب شکست |
1.611 |
نقطه اشتعال |
200.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|