CAS No: 3999-42-6, Chemical Name: borane-2,6-lutidine complex
Home | Products | Suppliers | Offer to Buy | Offer to Sell | Chemical News | Resource
Chemical CAS Database with Global Chemical Suppliers - ChemNet

Updated CAS

the physical and chemical property of 3999-42-6, borane-2,6-lutidine complex is provided by ChemNet.com

  ChemNet > CAS > 3999-42-6 borane-2,6-lutidine complex

3999-42-6 borane-2,6-lutidine complex

نام محصول borane-2,6-lutidine complex
مترادف 2,6-dimethylpyridine-borane
میدان مغناطیسی C7H12BN
وزن مولکولی 120.98
InChI InChI=1/C7H12BN/c1-6-4-3-5-7(2)9(6)8/h3-5H,1-2,8H3/q+1
شماره سیایاس 3999-42-6
تعداد کمیسیون اروپایی 223-645-1
ساختار مولکولی 3999-42-6 borane-2,6-lutidine complex
خطر نمادها
کدهای خطر
توضیحات ایمنی