ChemNet > CAS > 40771-26-4 1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene
40771-26-4 1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene
نام محصول |
1,5-Dihydroxy-1,2,3,4-tetrahydronaphthalene |
مترادف |
1,2,3,4-Tetrahydro-1,5-naphthalenediol; 1,2,3,4-tetrahydronaphthalene-1,5-diol; (1R)-1,2,3,4-tetrahydronaphthalene-1,5-diol; (1S)-1,2,3,4-tetrahydronaphthalene-1,5-diol |
میدان مغناطیسی |
C10H12O2 |
وزن مولکولی |
164.2011 |
InChI |
InChI=1/C10H12O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1,3,5,10-12H,2,4,6H2/t10-/m0/s1 |
شماره سیایاس |
40771-26-4 |
تعداد کمیسیون اروپایی |
255-070-7 |
ساختار مولکولی |
|
تراکم |
1.246g/cm3 |
نقطه ذوب |
132-134℃ |
نقطه غلیان |
325.9°C at 760 mmHg |
ضریب شکست |
1.624 |
نقطه اشتعال |
162.4°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|