ChemNet > CAS > 41200-96-8 2,4-Dichloro-5-isopropoxyaniline
41200-96-8 2,4-Dichloro-5-isopropoxyaniline
نام محصول |
2,4-Dichloro-5-isopropoxyaniline |
مترادف |
2,4-dichloro-5-(propan-2-yloxy)aniline |
میدان مغناطیسی |
C9H11Cl2NO |
وزن مولکولی |
220.0957 |
InChI |
InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3 |
شماره سیایاس |
41200-96-8 |
تعداد کمیسیون اروپایی |
255-258-9 |
ساختار مولکولی |
|
تراکم |
1.272g/cm3 |
نقطه غلیان |
310.8°C at 760 mmHg |
ضریب شکست |
1.562 |
نقطه اشتعال |
141.8°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|