ChemNet > CAS > 41200-96-8 2,4-Dichloro-5-isopropoxyaniline
41200-96-8 2,4-Dichloro-5-isopropoxyaniline
| نام محصول |
2,4-Dichloro-5-isopropoxyaniline |
| مترادف |
2,4-dichloro-5-(propan-2-yloxy)aniline |
| میدان مغناطیسی |
C9H11Cl2NO |
| وزن مولکولی |
220.0957 |
| InChI |
InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3 |
| شماره سیایاس |
41200-96-8 |
| تعداد کمیسیون اروپایی |
255-258-9 |
| ساختار مولکولی |
|
| تراکم |
1.272g/cm3 |
| نقطه غلیان |
310.8°C at 760 mmHg |
| ضریب شکست |
1.562 |
| نقطه اشتعال |
141.8°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
