ChemNet > CAS > 42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
نام محصول |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
مترادف |
3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
میدان مغناطیسی |
C10H7ClN4 |
وزن مولکولی |
218.6424 |
InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
شماره سیایاس |
42754-62-1 |
ساختار مولکولی |
|
تراکم |
1.48g/cm3 |
نقطه ذوب |
212℃ |
نقطه غلیان |
554.7°C at 760 mmHg |
ضریب شکست |
1.688 |
نقطه اشتعال |
289.3°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|