ChemNet > CAS > 4312-99-6 1-Octen-3-one
4312-99-6 1-Octen-3-one
نام محصول |
1-Octen-3-one |
مترادف |
n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
میدان مغناطیسی |
C8H14O |
وزن مولکولی |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
شماره سیایاس |
4312-99-6 |
تعداد کمیسیون اروپایی |
224-327-5 |
ساختار مولکولی |
|
تراکم |
0.825g/cm3 |
نقطه غلیان |
177°C at 760 mmHg |
ضریب شکست |
1.422 |
نقطه اشتعال |
58.5°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|