ChemNet > CAS > 4402-83-9 methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
4402-83-9 methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
نام محصول |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate |
مترادف |
methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
میدان مغناطیسی |
C12H9Cl2NO3 |
وزن مولکولی |
286.1108 |
InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
شماره سیایاس |
4402-83-9 |
ساختار مولکولی |
|
تراکم |
1.37g/cm3 |
نقطه ذوب |
115℃ |
نقطه غلیان |
382.4°C at 760 mmHg |
ضریب شکست |
1.561 |
نقطه اشتعال |
185.1°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|