ChemNet > CAS > 4424-17-3 2-Aminobenzanilide
4424-17-3 2-Aminobenzanilide
نام محصول |
2-Aminobenzanilide |
مترادف |
2-Amino-N-phenylbenzamide~Phenylanthranilamide; 2-amino-N-phenylbenzamide; N-(2-aminophenyl)benzamide |
میدان مغناطیسی |
C13H12N2O |
وزن مولکولی |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-11-8-4-5-9-12(11)15-13(16)10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16) |
شماره سیایاس |
4424-17-3 |
تعداد کمیسیون اروپایی |
224-599-5 |
ساختار مولکولی |
|
تراکم |
1.244g/cm3 |
نقطه غلیان |
293.2°C at 760 mmHg |
ضریب شکست |
1.688 |
نقطه اشتعال |
131.1°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|