ChemNet > CAS > 4463-33-6 2,3-Dimethoxytoluene
4463-33-6 2,3-Dimethoxytoluene
نام محصول |
2,3-Dimethoxytoluene |
مترادف |
3-Methylveratrole; 1,2-dimethoxy-3-methylbenzene |
میدان مغناطیسی |
C9H12O2 |
وزن مولکولی |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
شماره سیایاس |
4463-33-6 |
تعداد کمیسیون اروپایی |
224-726-4 |
ساختار مولکولی |
|
تراکم |
0.99g/cm3 |
نقطه غلیان |
201.4°C at 760 mmHg |
ضریب شکست |
1.489 |
نقطه اشتعال |
67.6°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|