ChemNet > CAS > 447-31-4 Desyl chloride
447-31-4 Desyl chloride
| نام محصول |
Desyl chloride |
| مترادف |
alpha-Chloro-alpha-phenylacetophenone; alpha-chlorodeoxybenzoin; 2-chloro-1,2-diphenylethanone; (2R)-2-chloro-1,2-diphenylethanone; (2S)-2-chloro-1,2-diphenylethanone |
| میدان مغناطیسی |
C14H11ClO |
| وزن مولکولی |
230.6895 |
| InChI |
InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| شماره سیایاس |
447-31-4 |
| تعداد کمیسیون اروپایی |
207-181-7 |
| ساختار مولکولی |
|
| تراکم |
1.19g/cm3 |
| نقطه ذوب |
65-69℃ |
| نقطه غلیان |
345.5°C at 760 mmHg |
| ضریب شکست |
1.592 |
| نقطه اشتعال |
190.4°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21:Harmful by inhalation and in contact with skin.;
R37:Irritating to respiratory system.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
|
|
