ChemNet > CAS > 455-37-8 3-fluorobenzamide
455-37-8 3-fluorobenzamide
نام محصول |
3-fluorobenzamide |
مترادف |
m-Fluorobenzamide |
میدان مغناطیسی |
C7H6FNO |
وزن مولکولی |
139.127 |
InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
شماره سیایاس |
455-37-8 |
تعداد کمیسیون اروپایی |
207-247-5 |
ساختار مولکولی |
|
تراکم |
1.238g/cm3 |
نقطه ذوب |
129-132℃ |
نقطه غلیان |
238.4°C at 760 mmHg |
ضریب شکست |
1.538 |
نقطه اشتعال |
98°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|