ChemNet > CAS > 4640-68-0 3,4-Dichlorobenzoylacetonitrile
4640-68-0 3,4-Dichlorobenzoylacetonitrile
نام محصول |
3,4-Dichlorobenzoylacetonitrile |
مترادف |
3-(3,4-dichlorophenyl)-3-oxopropanenitrile |
میدان مغناطیسی |
C9H5Cl2NO |
وزن مولکولی |
214.0481 |
InChI |
InChI=1/C9H5Cl2NO/c10-7-2-1-6(5-8(7)11)9(13)3-4-12/h1-2,5H,3H2 |
شماره سیایاس |
4640-68-0 |
ساختار مولکولی |
|
تراکم |
1.383g/cm3 |
نقطه غلیان |
398.4°C at 760 mmHg |
ضریب شکست |
1.567 |
نقطه اشتعال |
194.7°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|