ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| نام محصول |
2-aminothiophene-3-carbonitrile |
| مترادف |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| میدان مغناطیسی |
C5H4N2S |
| وزن مولکولی |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| شماره سیایاس |
4651-82-5 |
| ساختار مولکولی |
|
| تراکم |
1.33g/cm3 |
| نقطه ذوب |
104℃ |
| نقطه غلیان |
317.5°C at 760 mmHg |
| ضریب شکست |
1.627 |
| نقطه اشتعال |
145.8°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
