ChemNet > CAS > 4685-47-6 3,4-Dimethylanisole
4685-47-6 3,4-Dimethylanisole
نام محصول |
3,4-Dimethylanisole |
مترادف |
1,2-Dimethyl-4-methoxybenzene; 4-Methoxy-o-xylene; 3-(methoxycarbonyl)-1-methylpyridinium; 4-methoxy-1,2-dimethyl-benzene |
میدان مغناطیسی |
C9H12O |
وزن مولکولی |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3 |
شماره سیایاس |
4685-47-6 |
تعداد کمیسیون اروپایی |
225-142-2 |
ساختار مولکولی |
|
تراکم |
0.932g/cm3 |
نقطه غلیان |
203.1°C at 760 mmHg |
ضریب شکست |
1.495 |
نقطه اشتعال |
75.6°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|