CAS No: 4815-29-6, Chemical Name: 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid ethyl ester
the physical and chemical property of 4815-29-6, 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid ethyl ester is provided by ChemNet.com
ChemNet > CAS > 4815-29-6 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid ethyl ester
4815-29-6 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid ethyl ester
نام محصول |
2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid ethyl ester |
مترادف |
4H-Cyclopenta[b]thiophene-3-carboxylic acid, 2-amino-5,6-dihydro-, ethyl ester; ethyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate; Ethyl 2-aminocyclopenta[b]thiophene-3-carboxylate |
میدان مغناطیسی |
C10H13NO2S |
وزن مولکولی |
211.2807 |
InChI |
InChI=1/C10H13NO2S/c1-2-13-10(12)8-6-4-3-5-7(6)14-9(8)11/h2-5,11H2,1H3 |
شماره سیایاس |
4815-29-6 |
ساختار مولکولی |
|
تراکم |
1.282g/cm3 |
نقطه ذوب |
114-116℃ |
نقطه غلیان |
386.8°C at 760 mmHg |
ضریب شکست |
1.614 |
نقطه اشتعال |
187.7°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|