ChemNet > CAS > 499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
نام محصول |
1-benzyl-4-(3-nitropyridin-2-yl)piperazine |
میدان مغناطیسی |
C16H18N4O2 |
وزن مولکولی |
298.3397 |
InChI |
InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2 |
شماره سیایاس |
499771-07-2 |
ساختار مولکولی |
|
تراکم |
1.263g/cm3 |
نقطه ذوب |
64℃ |
نقطه غلیان |
453°C at 760 mmHg |
ضریب شکست |
1.628 |
نقطه اشتعال |
227.7°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|