ChemNet > CAS > 5102-79-4 2-Diphenylacetyl-1,3-indandione-1-hydrazone
5102-79-4 2-Diphenylacetyl-1,3-indandione-1-hydrazone
نام محصول |
2-Diphenylacetyl-1,3-indandione-1-hydrazone |
مترادف |
Difezon; NSC 83445; 1,3-Indandione, 2-(diphenylacetyl)-, 1-hydrazone (8CI); 1H-Indene-1,3(2H)-dione, 2-(diphenylacetyl)-, 1-hydrazone (9CI); 2-(Diphenylacetyl)-1H-indene-1,3(2H)-dione 1-hydrazone; 2-(diphenylacetyl)-3-hydrazinylidene-2,3-dihydro-1H-inden-1-one; (3Z)-2-(diphenylacetyl)-3-hydrazono-2,3-dihydro-1H-inden-1-one; 2-(diphenylacetyl)-3-hydrazino-1H-inden-1-one |
میدان مغناطیسی |
C23H18N2O2 |
وزن مولکولی |
354.4012 |
InChI |
InChI=1/C23H18N2O2/c24-25-21-17-13-7-8-14-18(17)22(26)20(21)23(27)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19,25H,24H2 |
شماره سیایاس |
5102-79-4 |
تعداد کمیسیون اروپایی |
225-821-3 |
ساختار مولکولی |
|
تراکم |
1.3g/cm3 |
نقطه ذوب |
241-243℃ |
نقطه غلیان |
593.6°C at 760 mmHg |
ضریب شکست |
1.695 |
نقطه اشتعال |
312.8°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|