ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
نام محصول |
2,5-Dibromo-3,4-dinitrothiophene |
مترادف |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
میدان مغناطیسی |
C4Br2N2O4S |
وزن مولکولی |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
شماره سیایاس |
52431-30-8 |
ساختار مولکولی |
|
تراکم |
2.459g/cm3 |
نقطه غلیان |
341.2°C at 760 mmHg |
ضریب شکست |
1.716 |
نقطه اشتعال |
160.2°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|