ChemNet > CAS > 526-94-3 sodium hydrogen tartrate monohydrate
526-94-3 sodium hydrogen tartrate monohydrate
نام محصول |
sodium hydrogen tartrate monohydrate |
مترادف |
Sodium hydrogen L-tartrate; Sodium bitartrate; L-Tartaric acid sodium salt; SODIUM TARTRATE ACID; Sodium bitartrate monohydrate; Sodium tartrate monobasic monohydrate; Tartaric acid monosodium salt; sodium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate; sodium 3-carboxy-2,3-dihydroxypropanoate hydrate |
میدان مغناطیسی |
C4H7NaO7 |
وزن مولکولی |
190.0839 |
InChI |
InChI=1/C4H6O6.Na.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+1;/p-1 |
شماره سیایاس |
526-94-3 |
تعداد کمیسیون اروپایی |
208-400-9 |
ساختار مولکولی |
|
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|