ChemNet > CAS > 5266-85-3 2-Methyl-6-isopropylaniline
5266-85-3 2-Methyl-6-isopropylaniline
| نام محصول |
2-Methyl-6-isopropylaniline |
| مترادف |
2-Methyl-6-(1-methylethyl)benzenamine; 2-Isopropyl-6-methylaniline; 6-isopropyl-o-toluidine; 2-methyl-6-(propan-2-yl)aniline |
| میدان مغناطیسی |
C10H15N |
| وزن مولکولی |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
| شماره سیایاس |
5266-85-3 |
| تعداد کمیسیون اروپایی |
226-083-5 |
| ساختار مولکولی |
|
| تراکم |
0.944g/cm3 |
| نقطه غلیان |
236.2°C at 760 mmHg |
| ضریب شکست |
1.538 |
| نقطه اشتعال |
97.8°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
