CAS No: 52663-69-1, Chemical Name: 2,2',3,4,4',5',6-heptachlorobiphenyl
the physical and chemical property of 52663-69-1, 2,2',3,4,4',5',6-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 52663-69-1 2,2',3,4,4',5',6-heptachlorobiphenyl
52663-69-1 2,2',3,4,4',5',6-heptachlorobiphenyl
| نام محصول |
2,2',3,4,4',5',6-heptachlorobiphenyl |
| مترادف |
1,1'-biphenyl, 2,2',3,4,4',5',6-heptachloro-; 2,2',3,4,4',5',6-PCB; 52663-69-1 |
| میدان مغناطیسی |
C12H3Cl7 |
| وزن مولکولی |
395.3232 |
| InChI |
InChI=1/C12H3Cl7/c13-5-2-7(15)6(14)1-4(5)10-8(16)3-9(17)11(18)12(10)19/h1-3H |
| شماره سیایاس |
52663-69-1 |
| ساختار مولکولی |
|
| تراکم |
1.658g/cm3 |
| نقطه غلیان |
407.2°C at 760 mmHg |
| ضریب شکست |
1.632 |
| نقطه اشتعال |
198.2°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
