ChemNet > CAS > 53233-89-9 5-Chloro-2,3-dihydroxypyridine
53233-89-9 5-Chloro-2,3-dihydroxypyridine
نام محصول |
5-Chloro-2,3-dihydroxypyridine |
مترادف |
5-Chloropyridine-2,3-diol; 5-chloro-3-hydroxypyridin-2(1H)-one |
میدان مغناطیسی |
C5H4ClNO2 |
وزن مولکولی |
145.5438 |
InChI |
InChI=1/C5H4ClNO2/c6-3-1-4(8)5(9)7-2-3/h1-2,8H,(H,7,9) |
شماره سیایاس |
53233-89-9 |
تعداد کمیسیون اروپایی |
258-441-1 |
ساختار مولکولی |
|
تراکم |
1.56g/cm3 |
نقطه ذوب |
295℃ |
نقطه غلیان |
297.6°C at 760 mmHg |
ضریب شکست |
1.617 |
نقطه اشتعال |
133.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|