ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
نام محصول |
thianaphthene-3-carboxaldehyde |
مترادف |
1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
میدان مغناطیسی |
C9H6OS |
وزن مولکولی |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
شماره سیایاس |
5381-20-4 |
ساختار مولکولی |
|
تراکم |
1.3g/cm3 |
نقطه ذوب |
56-58℃ |
نقطه غلیان |
303.2°C at 760 mmHg |
ضریب شکست |
1.719 |
نقطه اشتعال |
137.2°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|