ChemNet > CAS > 5398-27-6 2,6-Diiodo-4-nitroaniline
5398-27-6 2,6-Diiodo-4-nitroaniline
نام محصول |
2,6-Diiodo-4-nitroaniline |
مترادف |
1-(3-methylphenyl)-2,3,4,9-tetrahydro-1H-beta-carboline |
میدان مغناطیسی |
C18H18N2 |
وزن مولکولی |
262.3489 |
InChI |
InChI=1/C18H18N2/c1-12-5-4-6-13(11-12)17-18-15(9-10-19-17)14-7-2-3-8-16(14)20-18/h2-8,11,17,19-20H,9-10H2,1H3 |
شماره سیایاس |
5398-27-6 |
تعداد کمیسیون اروپایی |
226-429-5 |
ساختار مولکولی |
|
تراکم |
1.165g/cm3 |
نقطه ذوب |
251-256℃ |
نقطه غلیان |
455.4°C at 760 mmHg |
ضریب شکست |
1.661 |
نقطه اشتعال |
229.2°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|