ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
| نام محصول |
Cyclopentyl phenyl ketone |
| مترادف |
Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
| میدان مغناطیسی |
C12H14O |
| وزن مولکولی |
174.239 |
| InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
| شماره سیایاس |
5422-88-8 |
| تعداد کمیسیون اروپایی |
226-548-2 |
| ساختار مولکولی |
|
| تراکم |
1.051g/cm3 |
| نقطه غلیان |
273.9°C at 760 mmHg |
| ضریب شکست |
1.548 |
| نقطه اشتعال |
112.4°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
