ChemNet > CAS > 5447-99-4 3-Nitro-2-pentanol
5447-99-4 3-Nitro-2-pentanol
| نام محصول |
3-Nitro-2-pentanol |
| مترادف |
3-Nitro-2-pentanol,mixture of (?-threo and (?-erythro; 3-nitropentan-2-ol; (2R,3S)-3-nitropentan-2-ol; (2R,3R)-3-nitropentan-2-ol; (2S,3S)-3-nitropentan-2-ol; (2S,3R)-3-nitropentan-2-ol |
| میدان مغناطیسی |
C5H11NO3 |
| وزن مولکولی |
133.1457 |
| InChI |
InChI=1/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5+/m0/s1 |
| شماره سیایاس |
5447-99-4 |
| تعداد کمیسیون اروپایی |
226-669-0 |
| ساختار مولکولی |
|
| تراکم |
1.09g/cm3 |
| نقطه غلیان |
215.8°C at 760 mmHg |
| ضریب شکست |
1.447 |
| نقطه اشتعال |
90.6°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
