ChemNet > CAS > 5503-73-1 2-amino-4,5-diphenyl-3-furancarbonitrile
5503-73-1 2-amino-4,5-diphenyl-3-furancarbonitrile
نام محصول |
2-amino-4,5-diphenyl-3-furancarbonitrile |
مترادف |
2-Amino-4,5-diphenyl-3-furonitrile; 2-amino-4,5-diphenylfuran-3-carbonitrile; 2-(naphthalen-2-ylamino)-2-oxoethyl quinoline-2-carboxylate |
میدان مغناطیسی |
C22H16N2O3 |
وزن مولکولی |
356.374 |
InChI |
InChI=1/C22H16N2O3/c25-21(23-18-11-9-15-5-1-2-7-17(15)13-18)14-27-22(26)20-12-10-16-6-3-4-8-19(16)24-20/h1-13H,14H2,(H,23,25) |
شماره سیایاس |
5503-73-1 |
ساختار مولکولی |
|
تراکم |
1.338g/cm3 |
نقطه ذوب |
201-205℃ |
نقطه غلیان |
665.4°C at 760 mmHg |
ضریب شکست |
1.724 |
نقطه اشتعال |
356.2°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|