ChemNet > CAS > 555-90-8 Nicothiazone
555-90-8 Nicothiazone
| نام محصول |
Nicothiazone |
| مترادف |
3-Formylpyridine thiosemicarbazone; Nicotinaldehyde, thiocarbohydrazone; Nicotinaldehyde thiosemicarbazone; Pyridine-3-carboxaldehyde, thiosemicarbazone; ; 2-(pyridin-3-ylmethylidene)hydrazinecarbothioamide; pyridine-3-carbaldehyde thiosemicarbazone; Pyridine-3-aldehyde thiosemicarbazone |
| میدان مغناطیسی |
C7H8N4S |
| وزن مولکولی |
180.2302 |
| InChI |
InChI=1/C7H8N4S/c8-7(12)11-10-5-6-2-1-3-9-4-6/h1-5H,(H3,8,11,12)/b10-5+ |
| شماره سیایاس |
555-90-8 |
| تعداد کمیسیون اروپایی |
209-108-4 |
| ساختار مولکولی |
|
| تراکم |
1.32g/cm3 |
| نقطه غلیان |
346.5°C at 760 mmHg |
| ضریب شکست |
1.665 |
| نقطه اشتعال |
163.3°C |
| خطر نمادها |
|
| کدهای خطر |
R25:Toxic if swallowed.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
