ChemNet > CAS > 55912-20-4 4-Chloro-3-nitrobenzyl alcohol
55912-20-4 4-Chloro-3-nitrobenzyl alcohol
نام محصول |
4-Chloro-3-nitrobenzyl alcohol |
مترادف |
4-Chloro-3-nitrobenzenemethanol |
میدان مغناطیسی |
C7H6ClNO3 |
وزن مولکولی |
187.58 |
InChI |
InChI=1/C7H6ClNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-3,10H,4H2 |
شماره سیایاس |
55912-20-4 |
تعداد کمیسیون اروپایی |
259-901-4 |
ساختار مولکولی |
|
نقطه ذوب |
61-65℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|