ChemNet > CAS > 58081-05-3 (R)-(+)-beta-Hydroxy-gamma-butyrolactone
58081-05-3 (R)-(+)-beta-Hydroxy-gamma-butyrolactone
نام محصول |
(R)-(+)-beta-Hydroxy-gamma-butyrolactone |
مترادف |
(4R)-4-hydroxydihydrofuran-2(3H)-one; (R)-(+)-3-Hydroxybutyrolactone |
میدان مغناطیسی |
C4H6O3 |
وزن مولکولی |
102.0886 |
InChI |
InChI=1/C4H6O3/c5-3-1-4(6)7-2-3/h3,5H,1-2H2/t3-/m1/s1 |
شماره سیایاس |
58081-05-3 |
ساختار مولکولی |
|
تراکم |
1.393g/cm3 |
نقطه غلیان |
310.3°C at 760 mmHg |
ضریب شکست |
1.506 |
نقطه اشتعال |
157.1°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|