ChemNet > CAS > 589-62-8 4-octanol
589-62-8 4-octanol
| نام محصول |
4-octanol |
| مترادف |
n-Butyl n-propyl carbinol; octan-4-ol |
| میدان مغناطیسی |
C8H18O |
| وزن مولکولی |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| شماره سیایاس |
589-62-8 |
| تعداد کمیسیون اروپایی |
209-654-3 |
| ساختار مولکولی |
|
| تراکم |
0.821g/cm3 |
| نقطه غلیان |
179.2°C at 760 mmHg |
| ضریب شکست |
1.426 |
| نقطه اشتعال |
71.1°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
