ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
| نام محصول |
5-Nitro-2-furonitrile |
| مترادف |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| میدان مغناطیسی |
C5H2N2O3 |
| وزن مولکولی |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| شماره سیایاس |
59-82-5 |
| ساختار مولکولی |
|
| تراکم |
1.46g/cm3 |
| نقطه غلیان |
234.7°C at 760 mmHg |
| ضریب شکست |
1.544 |
| نقطه اشتعال |
95.7°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
