ChemNet > CAS > 59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
| نام محصول |
1-Acetylpiperidine-4-carbonyl chloride |
| مترادف |
N-Acetylisonipecotoyl chloride; 1-Acetylisonipecotoyl Chloride |
| میدان مغناطیسی |
C8H12ClNO2 |
| وزن مولکولی |
189.6394 |
| InChI |
InChI=1/C8H12ClNO2/c1-6(11)10-4-2-7(3-5-10)8(9)12/h7H,2-5H2,1H3 |
| شماره سیایاس |
59084-16-1 |
| تعداد کمیسیون اروپایی |
261-594-7 |
| ساختار مولکولی |
|
| تراکم |
1.224g/cm3 |
| نقطه غلیان |
308°C at 760 mmHg |
| ضریب شکست |
1.496 |
| نقطه اشتعال |
140.1°C |
| خطر نمادها |
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
