ChemNet > CAS > 60404-18-4 3-Bromo-2,5-dichlorothiophene
60404-18-4 3-Bromo-2,5-dichlorothiophene
| نام محصول |
3-Bromo-2,5-dichlorothiophene |
| میدان مغناطیسی |
C4HBrCl2S |
| وزن مولکولی |
231.9257 |
| InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| شماره سیایاس |
60404-18-4 |
| ساختار مولکولی |
|
| تراکم |
1.949g/cm3 |
| نقطه غلیان |
223.1°C at 760 mmHg |
| ضریب شکست |
1.625 |
| نقطه اشتعال |
88.7°C |
| خطر نمادها |
|
| کدهای خطر |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
